Multi component query: Difference between revisions

From DISI
Jump to navigation Jump to search
(asdf)
 
m (asdf)
 
Line 7: Line 7:
I began by pasting the smiles into swp / zinc22.  Fine, it find it and its 3 other stereoisomers in a second.  
I began by pasting the smiles into swp / zinc22.  Fine, it find it and its 3 other stereoisomers in a second.  


Suppose we had not found it? I found a way to break it up.  
Suppose we had not found it? I found a way to break it up.  
Start by clicking on the Multi-source box.  
Start by clicking on the Multi-source box.  
Now, delete the NH2.  Not much change. still finds the whole molecule.
Now, delete the NH2.  Not much change. still finds the whole molecule.
Now, break the bond from the aryl to the long chain, leaving the methyl ketone
Now, break the bond from the aryl to the long chain, leaving the methyl ketone
Now, you can see as the top two "hits" are fragments of each side of the broken bond.  
Now, you can see as the top two "hits" are fragments of each side of the broken bond.  
I'm not saying this is the answer, but it is an interesting feature that allows you to explore BB strategies.  
I'm not saying this is the answer, but it is an interesting feature that allows you to explore BB strategies.  





Latest revision as of 18:12, 21 February 2025

There is an option in Smallworld that I don't use much, but is kinda cool for fragment based decomposition.

I was looking for this molecule in ZINC-22 (swp)

Cc1cc(Br)cc([C@@H](N)C(=O)NC[C@H]2CCOC2=O)c1 ZINCkk00000BlI4q

I began by pasting the smiles into swp / zinc22. Fine, it find it and its 3 other stereoisomers in a second.

Suppose we had not found it? I found a way to break it up. 
Start by clicking on the Multi-source box. 
Now, delete the NH2.   Not much change. still finds the whole molecule.
Now, break the bond from the aryl to the long chain, leaving the methyl ketone
Now, you can see as the top two "hits" are fragments of each side of the broken bond. 
I'm not saying this is the answer, but it is an interesting feature that allows you to explore BB strategies.